C20H19ClFN5OS — CID 40981366
(6S,7R)-N-(2-chlorophenyl)-6-(4-fluorophenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 40981366) has the molecular formula C20H19ClFN5OS and a molecular weight of 431.92 g/mol. Its IUPAC name is (6S,7R)-N-(2-chlorophenyl)-6-(4-fluorophenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | (6S,7R)-N-(2-chlorophenyl)-6-(4-fluorophenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 40981366 |
| Molecular Formula | C20H19ClFN5OS |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (6S,7R)-N-(2-chlorophenyl)-6-(4-fluorophenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | CCCc1nnc2n1N[C@@H](c1ccc(F)cc1)[C@H](C(=O)Nc1ccccc1Cl)S2 |
| InChI | InChI=1S/C20H19ClFN5OS/c1-2-5-16-24-25-20-27(16)26-17(12-8-10-13(22)11-9-12)18(29-20)19(28)23-15-7-4-3-6-14(15)21/h3-4,6-11,17-18,26H,2,5H2,1H3,(H,23,28)/t17-,18+/m0/s1 |
| InChIKey | KHEIFIGMCBEZAG-ZWKOTPCHSA-N |
| XLogP | 4.42 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |