C34H30N2O2P2S2 — CID 4098268
N,N'-bis(4-oxo-2,6-diphenyl-1,4λ5-thiaphosphinin-4-yl)ethane-1,2-diamine (PubChem CID 4098268) has the molecular formula C34H30N2O2P2S2 and a molecular weight of 624.71 g/mol. Its IUPAC name is N,N'-bis(4-oxo-2,6-diphenyl-1,4λ5-thiaphosphinin-4-yl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(4-oxo-2,6-diphenyl-1,4λ5-thiaphosphinin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 4098268 |
| Molecular Formula | C34H30N2O2P2S2 |
| Molecular Weight | 624.71 g/mol |
| Exact Mass | 624.12 |
| IUPAC Name | N,N'-bis(4-oxo-2,6-diphenyl-1,4λ5-thiaphosphinin-4-yl)ethane-1,2-diamine |
| SMILES | O=P1(NCCNP2(=O)C=C(c3ccccc3)SC(c3ccccc3)=C2)C=C(c2ccccc2)SC(c2ccccc2)=C1 |
| InChI | InChI=1S/C34H30N2O2P2S2/c37-39(23-31(27-13-5-1-6-14-27)41-32(24-39)28-15-7-2-8-16-28)35-21-22-36-40(38)25-33(29-17-9-3-10-18-29)42-34(26-40)30-19-11-4-12-20-30/h1-20,23-26H,21-22H2,(H,35,37)(H,36,38) |
| InChIKey | JMLXZCIBKXSNHK-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.71 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|