C18H14ClFN2O3S — CID 4098317
ethyl 2-[2-(3-chlorobenzoyl)imino-4-fluoro-1,3-benzothiazol-3-yl]acetate (PubChem CID 4098317) has the molecular formula C18H14ClFN2O3S and a molecular weight of 392.84 g/mol. Its IUPAC name is ethyl 2-[2-(3-chlorobenzoyl)imino-4-fluoro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(3-chlorobenzoyl)imino-4-fluoro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4098317 |
| Molecular Formula | C18H14ClFN2O3S |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | ethyl 2-[2-(3-chlorobenzoyl)imino-4-fluoro-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cccc(Cl)c2)sc2cccc(F)c21 |
| InChI | InChI=1S/C18H14ClFN2O3S/c1-2-25-15(23)10-22-16-13(20)7-4-8-14(16)26-18(22)21-17(24)11-5-3-6-12(19)9-11/h3-9H,2,10H2,1H3/b21-18- |
| InChIKey | CXVONKIRSDOSMH-UZYVYHOESA-N |
| XLogP | 3.80 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |