About [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate
[(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 40985896) has the molecular formula C16H15ClN2O4
and a molecular weight of 334.76 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate.
Molecular Properties
| Compound Name | [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate |
| PubChem CID | 40985896 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | Cc1nn(-c2ccc(C(=O)O[C@@H]3CCOC3=O)cc2)c(C)c1Cl |
| InChI | InChI=1S/C16H15ClN2O4/c1-9-14(17)10(2)19(18-9)12-5-3-11(4-6-12)15(20)23-13-7-8-22-16(13)21/h3-6,13H,7-8H2,1-2H3/t13-/m1/s1 |
| InChIKey | DLTXCOJCKRVUDC-CYBMUJFWSA-N |
| XLogP | 2.61 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate?
The IUPAC name of [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate (CID 40985896) is [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate.
What is the SMILES notation for [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate?
The canonical SMILES for [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate is Cc1nn(-c2ccc(C(=O)O[C@@H]3CCOC3=O)cc2)c(C)c1Cl.
What is the InChIKey of [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate?
The InChIKey is DLTXCOJCKRVUDC-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H15ClN2O4/c1-9-14(17)10(2)19(18-9)12-5-3-11(4-6-12)15(20)23-13-7-8-22-16(13)21/h3-6,13H,7-8H2,1-2H3/t13-/m1/s1.
What are the key properties of [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate?
[(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate has a molecular weight of 334.76 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-2-oxooxolan-3-yl] 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate is sourced from PubChem (CID 40985896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).