C37H64O3Si2 — CID 4098651
[2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-trimethylsilyloxyphenyl)-ethoxymethyl]phenoxy]-trimethylsilane (PubChem CID 4098651) has the molecular formula C37H64O3Si2 and a molecular weight of 613.09 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-trimethylsilyloxyphenyl)-ethoxymethyl]phenoxy]-trimethylsilane.
| Compound Name | [2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-trimethylsilyloxyphenyl)-ethoxymethyl]phenoxy]-trimethylsilane |
|---|---|
| PubChem CID | 4098651 |
| Molecular Formula | C37H64O3Si2 |
| Molecular Weight | 613.09 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | [2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-trimethylsilyloxyphenyl)-ethoxymethyl]phenoxy]-trimethylsilane |
| SMILES | CCOC(c1cc(C(C)(C)C)c(O[Si](C)(C)C)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(O[Si](C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C37H64O3Si2/c1-20-38-31(25-21-27(34(2,3)4)32(39-41(14,15)16)28(22-25)35(5,6)7)26-23-29(36(8,9)10)33(40-42(17,18)19)30(24-26)37(11,12)13/h21-24,31H,20H2,1-19H3 |
| InChIKey | XYJFWGBDBONCPR-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.09 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|