C19H16IN3O2S — CID 40989658
(5R)-5-[(4-iodo-3-methylphenyl)iminomethyl]-1-(4-methylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 40989658) has the molecular formula C19H16IN3O2S and a molecular weight of 477.33 g/mol. Its IUPAC name is (5R)-5-[(4-iodo-3-methylphenyl)iminomethyl]-1-(4-methylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5R)-5-[(4-iodo-3-methylphenyl)iminomethyl]-1-(4-methylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 40989658 |
| Molecular Formula | C19H16IN3O2S |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | (5R)-5-[(4-iodo-3-methylphenyl)iminomethyl]-1-(4-methylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)[C@H](/C=N/c3ccc(I)c(C)c3)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C19H16IN3O2S/c1-11-3-6-14(7-4-11)23-18(25)15(17(24)22-19(23)26)10-21-13-5-8-16(20)12(2)9-13/h3-10,15H,1-2H3,(H,22,24,26)/b21-10+/t15-/m1/s1 |
| InChIKey | PQMRJCHPCDEMAF-SBUZPKSBSA-N |
| XLogP | 3.67 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|