C13H18F3N3O3S — CID 4099293
methyl 3,3,3-trifluoro-2-(3-methylbutanoylamino)-2-[(5-methyl-1,3-thiazol-2-yl)amino]propanoate (PubChem CID 4099293) has the molecular formula C13H18F3N3O3S and a molecular weight of 353.37 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-(3-methylbutanoylamino)-2-[(5-methyl-1,3-thiazol-2-yl)amino]propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-(3-methylbutanoylamino)-2-[(5-methyl-1,3-thiazol-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 4099293 |
| Molecular Formula | C13H18F3N3O3S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-(3-methylbutanoylamino)-2-[(5-methyl-1,3-thiazol-2-yl)amino]propanoate |
| SMILES | COC(=O)C(NC(=O)CC(C)C)(Nc1ncc(C)s1)C(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O3S/c1-7(2)5-9(20)18-12(10(21)22-4,13(14,15)16)19-11-17-6-8(3)23-11/h6-7H,5H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | FRVSJFDOWKLHBC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|