C25H30FN7O2 — CID 4099794
N-(3-fluoro-4-methylphenyl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 4099794) has the molecular formula C25H30FN7O2 and a molecular weight of 479.56 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(3-fluoro-4-methylphenyl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 4099794 |
| Molecular Formula | C25H30FN7O2 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(N2CCN(c3nc(Nc4ccc(C)c(F)c4)nc(N4CCOCC4)n3)CC2)cc1 |
| InChI | InChI=1S/C25H30FN7O2/c1-18-3-4-19(17-22(18)26)27-23-28-24(30-25(29-23)33-13-15-35-16-14-33)32-11-9-31(10-12-32)20-5-7-21(34-2)8-6-20/h3-8,17H,9-16H2,1-2H3,(H,27,28,29,30) |
| InChIKey | SWUPHWALVBHIJI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|