About 2-methylbutanimidamide
2-methylbutanimidamide (PubChem CID 4099958) has the molecular formula C5H12N2
and a molecular weight of 100.16 g/mol. Its IUPAC name is 2-methylbutanimidamide.
Molecular Properties
| Compound Name | 2-methylbutanimidamide |
| PubChem CID | 4099958 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | 2-methylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)CC |
| InChI | InChI=1S/C5H12N2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H3,6,7) |
| InChIKey | VEXJSFASSDRQRD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutanimidamide?
The IUPAC name of 2-methylbutanimidamide (CID 4099958) is 2-methylbutanimidamide.
What is the SMILES notation for 2-methylbutanimidamide?
The canonical SMILES for 2-methylbutanimidamide is [H]/N=C(\N)C(C)CC.
What is the InChIKey of 2-methylbutanimidamide?
The InChIKey is VEXJSFASSDRQRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H3,6,7).
What are the key properties of 2-methylbutanimidamide?
2-methylbutanimidamide has a molecular weight of 100.16 g/mol, XLogP of 0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutanimidamide is sourced from PubChem (CID 4099958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).