C23H16Cl2N2O3 — CID 40999852
(5S,10bS)-2-(1,3-benzodioxol-5-yl)-5-(2,4-dichlorophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 40999852) has the molecular formula C23H16Cl2N2O3 and a molecular weight of 439.30 g/mol. Its IUPAC name is (5S,10bS)-2-(1,3-benzodioxol-5-yl)-5-(2,4-dichlorophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | (5S,10bS)-2-(1,3-benzodioxol-5-yl)-5-(2,4-dichlorophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 40999852 |
| Molecular Formula | C23H16Cl2N2O3 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | (5S,10bS)-2-(1,3-benzodioxol-5-yl)-5-(2,4-dichlorophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | Clc1ccc([C@@H]2Oc3ccccc3[C@@H]3CC(c4ccc5c(c4)OCO5)=NN32)c(Cl)c1 |
| InChI | InChI=1S/C23H16Cl2N2O3/c24-14-6-7-15(17(25)10-14)23-27-19(16-3-1-2-4-20(16)30-23)11-18(26-27)13-5-8-21-22(9-13)29-12-28-21/h1-10,19,23H,11-12H2/t19-,23-/m0/s1 |
| InChIKey | YFVDRWSYNVHUJT-CVDCTZTESA-N |
| XLogP | 5.96 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |