About (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one
(2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one (PubChem CID 41000647) has the molecular formula C18H18FN3O4S2
and a molecular weight of 423.49 g/mol. Its IUPAC name is (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one |
| PubChem CID | 41000647 |
| Molecular Formula | C18H18FN3O4S2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2S[C@H]1Nc1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H18FN3O4S2/c19-13-6-5-12(11-16(13)28(24,25)22-7-9-26-10-8-22)20-18-17(23)21-14-3-1-2-4-15(14)27-18/h1-6,11,18,20H,7-10H2,(H,21,23)/t18-/m1/s1 |
| InChIKey | RJROCBBQFXMIBM-GOSISDBHSA-N |
| XLogP | 2.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one?
The IUPAC name of (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one (CID 41000647) is (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one?
The canonical SMILES for (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one is O=C1Nc2ccccc2S[C@H]1Nc1ccc(F)c(S(=O)(=O)N2CCOCC2)c1.
What is the InChIKey of (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one?
The InChIKey is RJROCBBQFXMIBM-GOSISDBHSA-N. The full InChI is InChI=1S/C18H18FN3O4S2/c19-13-6-5-12(11-16(13)28(24,25)22-7-9-26-10-8-22)20-18-17(23)21-14-3-1-2-4-15(14)27-18/h1-6,11,18,20H,7-10H2,(H,21,23)/t18-/m1/s1.
What are the key properties of (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one?
(2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one has a molecular weight of 423.49 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 41000647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).