C24H32F8N2O2 — CID 4100261
N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,2,3,3,4,4,5,5-octafluorohexanediamide (PubChem CID 4100261) has the molecular formula C24H32F8N2O2 and a molecular weight of 532.52 g/mol. Its IUPAC name is N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,2,3,3,4,4,5,5-octafluorohexanediamide.
| Compound Name | N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,2,3,3,4,4,5,5-octafluorohexanediamide |
|---|---|
| PubChem CID | 4100261 |
| Molecular Formula | C24H32F8N2O2 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,2,3,3,4,4,5,5-octafluorohexanediamide |
| SMILES | CC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NC(C)C1CC2CCC1C2)C1CC2CCC1C2 |
| InChI | InChI=1S/C24H32F8N2O2/c1-11(17-9-13-3-5-15(17)7-13)33-19(35)21(25,26)23(29,30)24(31,32)22(27,28)20(36)34-12(2)18-10-14-4-6-16(18)8-14/h11-18H,3-10H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | YUBMXFDULICDCZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|