C23H23ClN2O4 — CID 4100309
6-chloro-17-(2-methoxybenzoyl)-12-methyl-2-oxa-12,15-diazatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one (PubChem CID 4100309) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is 6-chloro-17-(2-methoxybenzoyl)-12-methyl-2-oxa-12,15-diazatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one.
| Compound Name | 6-chloro-17-(2-methoxybenzoyl)-12-methyl-2-oxa-12,15-diazatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one |
|---|---|
| PubChem CID | 4100309 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 6-chloro-17-(2-methoxybenzoyl)-12-methyl-2-oxa-12,15-diazatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one |
| SMILES | COc1ccccc1C(=O)C1C(=O)NC23CCN(C)CC2C1c1cc(Cl)ccc1O3 |
| InChI | InChI=1S/C23H23ClN2O4/c1-26-10-9-23-16(12-26)19(15-11-13(24)7-8-18(15)30-23)20(22(28)25-23)21(27)14-5-3-4-6-17(14)29-2/h3-8,11,16,19-20H,9-10,12H2,1-2H3,(H,25,28) |
| InChIKey | YJYZDHQJYYISBF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|