C29H24ClNO4 — CID 41004481
(1R,2R,3aR)-7-chloro-1-(2,2-dimethylpropanoyl)-2-(furan-2-yl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 41004481) has the molecular formula C29H24ClNO4 and a molecular weight of 485.97 g/mol. Its IUPAC name is (1R,2R,3aR)-7-chloro-1-(2,2-dimethylpropanoyl)-2-(furan-2-yl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1R,2R,3aR)-7-chloro-1-(2,2-dimethylpropanoyl)-2-(furan-2-yl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 41004481 |
| Molecular Formula | C29H24ClNO4 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (1R,2R,3aR)-7-chloro-1-(2,2-dimethylpropanoyl)-2-(furan-2-yl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | CC(C)(C)C(=O)[C@H]1[C@H](c2ccco2)C2(C(=O)c3ccccc3C2=O)[C@H]2C=Cc3cc(Cl)ccc3N12 |
| InChI | InChI=1S/C29H24ClNO4/c1-28(2,3)27(34)24-23(21-9-6-14-35-21)29(25(32)18-7-4-5-8-19(18)26(29)33)22-13-10-16-15-17(30)11-12-20(16)31(22)24/h4-15,22-24H,1-3H3/t22-,23+,24-/m1/s1 |
| InChIKey | SOUDAMGPZWSNBN-TZRRMPRUSA-N |
| XLogP | 5.98 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|