C17H18FN3O3S — CID 41008721
(3R)-1-(4-fluorophenyl)sulfonyl-N-pyridin-4-ylpiperidine-3-carboxamide (PubChem CID 41008721) has the molecular formula C17H18FN3O3S and a molecular weight of 363.41 g/mol. Its IUPAC name is (3R)-1-(4-fluorophenyl)sulfonyl-N-pyridin-4-ylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-(4-fluorophenyl)sulfonyl-N-pyridin-4-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 41008721 |
| Molecular Formula | C17H18FN3O3S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (3R)-1-(4-fluorophenyl)sulfonyl-N-pyridin-4-ylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccncc1)[C@@H]1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H18FN3O3S/c18-14-3-5-16(6-4-14)25(23,24)21-11-1-2-13(12-21)17(22)20-15-7-9-19-10-8-15/h3-10,13H,1-2,11-12H2,(H,19,20,22)/t13-/m1/s1 |
| InChIKey | YLWHKSUOFPXILQ-CYBMUJFWSA-N |
| XLogP | 2.26 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |