C20H10ClN3O4 — CID 41009569
(3S)-2'-amino-5-chloro-2,5'-dioxospiro[1H-indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile (PubChem CID 41009569) has the molecular formula C20H10ClN3O4 and a molecular weight of 391.77 g/mol. Its IUPAC name is (3S)-2'-amino-5-chloro-2,5'-dioxospiro[1H-indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile.
| Compound Name | (3S)-2'-amino-5-chloro-2,5'-dioxospiro[1H-indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile |
|---|---|
| PubChem CID | 41009569 |
| Molecular Formula | C20H10ClN3O4 |
| Molecular Weight | 391.77 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | (3S)-2'-amino-5-chloro-2,5'-dioxospiro[1H-indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(=O)oc3ccccc23)[C@@]12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C20H10ClN3O4/c21-9-5-6-13-11(7-9)20(19(26)24-13)12(8-22)17(23)28-16-10-3-1-2-4-14(10)27-18(25)15(16)20/h1-7H,23H2,(H,24,26)/t20-/m0/s1 |
| InChIKey | PPVTWZVPSWKGRQ-FQEVSTJZSA-N |
| XLogP | 2.77 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|