C4H4N6O7 — CID 41010642
(5R,6R)-4,7-dinitro-5,6-dihydro-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diol (PubChem CID 41010642) has the molecular formula C4H4N6O7 and a molecular weight of 248.11 g/mol. Its IUPAC name is (5R,6R)-4,7-dinitro-5,6-dihydro-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diol.
| Compound Name | (5R,6R)-4,7-dinitro-5,6-dihydro-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diol |
|---|---|
| PubChem CID | 41010642 |
| Molecular Formula | C4H4N6O7 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | (5R,6R)-4,7-dinitro-5,6-dihydro-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diol |
| SMILES | O=[N+]([O-])N1c2nonc2N([N+](=O)[O-])[C@H](O)[C@H]1O |
| InChI | InChI=1S/C4H4N6O7/c11-3-4(12)8(10(15)16)2-1(5-17-6-2)7(3)9(13)14/h3-4,11-12H/t3-,4-/m1/s1 |
| InChIKey | QPLCHHFGZQKMSB-QWWZWVQMSA-N |
| XLogP | -2.28 |
| TPSA | 172.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|