C30H31NO7 — CID 41012381
(5R)-5-(3-ethoxy-4-propoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione (PubChem CID 41012381) has the molecular formula C30H31NO7 and a molecular weight of 517.58 g/mol. Its IUPAC name is (5R)-5-(3-ethoxy-4-propoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(3-ethoxy-4-propoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41012381 |
| Molecular Formula | C30H31NO7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | (5R)-5-(3-ethoxy-4-propoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc([C@@H]2C(=C(O)c3ccc4c(c3)C[C@@H](C)O4)C(=O)C(=O)N2Cc2ccco2)cc1OCC |
| InChI | InChI=1S/C30H31NO7/c1-4-12-37-24-11-8-19(16-25(24)35-5-2)27-26(29(33)30(34)31(27)17-22-7-6-13-36-22)28(32)20-9-10-23-21(15-20)14-18(3)38-23/h6-11,13,15-16,18,27,32H,4-5,12,14,17H2,1-3H3/t18-,27-/m1/s1 |
| InChIKey | IZKBPPGLCPMLBM-DNOBIOAJSA-N |
| XLogP | 5.41 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|