C16H16F3N3OS2 — CID 41014423
[(1R)-1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl] pyrrolidine-1-carbodithioate (PubChem CID 41014423) has the molecular formula C16H16F3N3OS2 and a molecular weight of 387.45 g/mol. Its IUPAC name is [(1R)-1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [(1R)-1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 41014423 |
| Molecular Formula | C16H16F3N3OS2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [(1R)-1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl] pyrrolidine-1-carbodithioate |
| SMILES | C[C@@H](SC(=S)N1CCCC1)c1nc(-c2cccc(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C16H16F3N3OS2/c1-10(25-15(24)22-7-2-3-8-22)14-20-13(21-23-14)11-5-4-6-12(9-11)16(17,18)19/h4-6,9-10H,2-3,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | HGJLRQOKDREJGM-SNVBAGLBSA-N |
| XLogP | 4.93 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|