About 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea
1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea (PubChem CID 4101591) has the molecular formula C14H13N3O2S2
and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea.
Molecular Properties
| Compound Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea |
| PubChem CID | 4101591 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea |
| SMILES | CCOc1ccc2nc(NC(=O)Nc3cccs3)sc2c1 |
| InChI | InChI=1S/C14H13N3O2S2/c1-2-19-9-5-6-10-11(8-9)21-14(15-10)17-13(18)16-12-4-3-7-20-12/h3-8H,2H2,1H3,(H2,15,16,17,18) |
| InChIKey | JBLGCZDPPLPWSW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea?
The IUPAC name of 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea (CID 4101591) is 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea.
What is the SMILES notation for 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea?
The canonical SMILES for 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea is CCOc1ccc2nc(NC(=O)Nc3cccs3)sc2c1.
What is the InChIKey of 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea?
The InChIKey is JBLGCZDPPLPWSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2S2/c1-2-19-9-5-6-10-11(8-9)21-14(15-10)17-13(18)16-12-4-3-7-20-12/h3-8H,2H2,1H3,(H2,15,16,17,18).
What are the key properties of 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea?
1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea has a molecular weight of 319.41 g/mol, XLogP of 4.40, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea is sourced from PubChem (CID 4101591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).