C21H21N3O7S — CID 41018027
3-O-ethyl 6-O-methyl 2-[[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (PubChem CID 41018027) has the molecular formula C21H21N3O7S and a molecular weight of 459.48 g/mol. Its IUPAC name is 3-O-ethyl 6-O-methyl 2-[[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate.
| Compound Name | 3-O-ethyl 6-O-methyl 2-[[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 41018027 |
| Molecular Formula | C21H21N3O7S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 3-O-ethyl 6-O-methyl 2-[[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C\c2ccc([N+](=O)[O-])cc2)sc2c1CCN(C(=O)OC)C2 |
| InChI | InChI=1S/C21H21N3O7S/c1-3-31-20(26)18-15-10-11-23(21(27)30-2)12-16(15)32-19(18)22-17(25)9-6-13-4-7-14(8-5-13)24(28)29/h4-9H,3,10-12H2,1-2H3,(H,22,25)/b9-6- |
| InChIKey | ZWKCEBDEONVRSE-TWGQIWQCSA-N |
| XLogP | 3.61 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|