C22H27N3O5S — CID 41018116
methyl 3-carbamoyl-2-[(3-pentoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 41018116) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is methyl 3-carbamoyl-2-[(3-pentoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | methyl 3-carbamoyl-2-[(3-pentoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 41018116 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | methyl 3-carbamoyl-2-[(3-pentoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | CCCCCOc1cccc(C(=O)Nc2sc3c(c2C(N)=O)CCN(C(=O)OC)C3)c1 |
| InChI | InChI=1S/C22H27N3O5S/c1-3-4-5-11-30-15-8-6-7-14(12-15)20(27)24-21-18(19(23)26)16-9-10-25(22(28)29-2)13-17(16)31-21/h6-8,12H,3-5,9-11,13H2,1-2H3,(H2,23,26)(H,24,27) |
| InChIKey | PJDICFHFEUHOQS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|