C32H35N3O4 — CID 4101818
3-N,5-N-bis(2,6-dimethylphenyl)-4-(4-hydroxy-3-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 4101818) has the molecular formula C32H35N3O4 and a molecular weight of 525.65 g/mol. Its IUPAC name is 3-N,5-N-bis(2,6-dimethylphenyl)-4-(4-hydroxy-3-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis(2,6-dimethylphenyl)-4-(4-hydroxy-3-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 4101818 |
| Molecular Formula | C32H35N3O4 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 3-N,5-N-bis(2,6-dimethylphenyl)-4-(4-hydroxy-3-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | COc1cc(C2C(C(=O)Nc3c(C)cccc3C)=C(C)NC(C)=C2C(=O)Nc2c(C)cccc2C)ccc1O |
| InChI | InChI=1S/C32H35N3O4/c1-17-10-8-11-18(2)29(17)34-31(37)26-21(5)33-22(6)27(28(26)23-14-15-24(36)25(16-23)39-7)32(38)35-30-19(3)12-9-13-20(30)4/h8-16,28,33,36H,1-7H3,(H,34,37)(H,35,38) |
| InChIKey | GSUMHKHETMWLAT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |