C22H21N5O4S — CID 41019128
N-(2-nitrophenyl)-2-[[2-oxo-1-(pyridin-4-ylmethyl)-5,6,7,8-tetrahydroquinazolin-4-yl]sulfanyl]acetamide (PubChem CID 41019128) has the molecular formula C22H21N5O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is N-(2-nitrophenyl)-2-[[2-oxo-1-(pyridin-4-ylmethyl)-5,6,7,8-tetrahydroquinazolin-4-yl]sulfanyl]acetamide.
| Compound Name | N-(2-nitrophenyl)-2-[[2-oxo-1-(pyridin-4-ylmethyl)-5,6,7,8-tetrahydroquinazolin-4-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 41019128 |
| Molecular Formula | C22H21N5O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-(2-nitrophenyl)-2-[[2-oxo-1-(pyridin-4-ylmethyl)-5,6,7,8-tetrahydroquinazolin-4-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(=O)n(Cc2ccncc2)c2c1CCCC2)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H21N5O4S/c28-20(24-17-6-2-4-8-19(17)27(30)31)14-32-21-16-5-1-3-7-18(16)26(22(29)25-21)13-15-9-11-23-12-10-15/h2,4,6,8-12H,1,3,5,7,13-14H2,(H,24,28) |
| InChIKey | RBZVXYSJZPHTBE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|