C27H29N3O3S — CID 41020629
(2E,5S)-5-butyl-2-[(Z)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 41020629) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is (2E,5S)-5-butyl-2-[(Z)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5S)-5-butyl-2-[(Z)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 41020629 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (2E,5S)-5-butyl-2-[(Z)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CCCC[C@@H]1S/C(=N/N=C\c2ccc(OC)cc2OC)N(Cc2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C27H29N3O3S/c1-4-5-13-25-26(31)30(18-21-11-8-10-19-9-6-7-12-23(19)21)27(34-25)29-28-17-20-14-15-22(32-2)16-24(20)33-3/h6-12,14-17,25H,4-5,13,18H2,1-3H3/b28-17-,29-27+/t25-/m0/s1 |
| InChIKey | XJCTXFAENBGQJR-SPNHVPQRSA-N |
| XLogP | 5.88 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|