C31H31F2N3O2 — CID 41021129
(10bS)-2-[3-(difluoromethoxy)phenyl]-1'-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine] (PubChem CID 41021129) has the molecular formula C31H31F2N3O2 and a molecular weight of 515.60 g/mol. Its IUPAC name is (10bS)-2-[3-(difluoromethoxy)phenyl]-1'-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine].
| Compound Name | (10bS)-2-[3-(difluoromethoxy)phenyl]-1'-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine] |
|---|---|
| PubChem CID | 41021129 |
| Molecular Formula | C31H31F2N3O2 |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (10bS)-2-[3-(difluoromethoxy)phenyl]-1'-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine] |
| SMILES | FC(F)Oc1cccc(C2=NN3[C@@H](C2)c2ccccc2OC32CCN([C@H]3CCCc4ccccc43)CC2)c1 |
| InChI | InChI=1S/C31H31F2N3O2/c32-30(33)37-23-10-5-9-22(19-23)26-20-28-25-12-3-4-14-29(25)38-31(36(28)34-26)15-17-35(18-16-31)27-13-6-8-21-7-1-2-11-24(21)27/h1-5,7,9-12,14,19,27-28,30H,6,8,13,15-18,20H2/t27-,28-/m0/s1 |
| InChIKey | CTHQDRHOBNALTE-NSOVKSMOSA-N |
| XLogP | 6.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |