C14H16F8N2O6 — CID 4102259
ethyl 2-[[6-[(2-ethoxy-2-oxoethyl)amino]-2,2,3,3,4,4,5,5-octafluoro-6-oxohexanoyl]amino]acetate (PubChem CID 4102259) has the molecular formula C14H16F8N2O6 and a molecular weight of 460.27 g/mol. Its IUPAC name is ethyl 2-[[6-[(2-ethoxy-2-oxoethyl)amino]-2,2,3,3,4,4,5,5-octafluoro-6-oxohexanoyl]amino]acetate.
| Compound Name | ethyl 2-[[6-[(2-ethoxy-2-oxoethyl)amino]-2,2,3,3,4,4,5,5-octafluoro-6-oxohexanoyl]amino]acetate |
|---|---|
| PubChem CID | 4102259 |
| Molecular Formula | C14H16F8N2O6 |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | ethyl 2-[[6-[(2-ethoxy-2-oxoethyl)amino]-2,2,3,3,4,4,5,5-octafluoro-6-oxohexanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NCC(=O)OCC |
| InChI | InChI=1S/C14H16F8N2O6/c1-3-29-7(25)5-23-9(27)11(15,16)13(19,20)14(21,22)12(17,18)10(28)24-6-8(26)30-4-2/h3-6H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | ITFIMZSQTPYEAS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|