C13H14F9NO — CID 4102295
N-[2-(cyclohexen-1-yl)ethyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide (PubChem CID 4102295) has the molecular formula C13H14F9NO and a molecular weight of 371.24 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
|---|---|
| PubChem CID | 4102295 |
| Molecular Formula | C13H14F9NO |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
| SMILES | O=C(NCCC1=CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H14F9NO/c14-10(15,11(16,17)12(18,19)13(20,21)22)9(24)23-7-6-8-4-2-1-3-5-8/h4H,1-3,5-7H2,(H,23,24) |
| InChIKey | CFFBRULNLOUKBW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|