C21H22N4O2 — CID 4102387
3-(4-ethoxyphenyl)-N-[1-(4-methylphenyl)ethylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 4102387) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-N-[1-(4-methylphenyl)ethylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-ethoxyphenyl)-N-[1-(4-methylphenyl)ethylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4102387 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-(4-ethoxyphenyl)-N-[1-(4-methylphenyl)ethylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)NN=C(C)c3ccc(C)cc3)[nH]n2)cc1 |
| InChI | InChI=1S/C21H22N4O2/c1-4-27-18-11-9-17(10-12-18)19-13-20(24-23-19)21(26)25-22-15(3)16-7-5-14(2)6-8-16/h5-13H,4H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | ICNLMTMMASISMH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|