C23H18ClFN6O — CID 41025107
(Z)-1-(4-chlorophenyl)-N-[[10-(4-fluorophenyl)-11,12-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]methanimine (PubChem CID 41025107) has the molecular formula C23H18ClFN6O and a molecular weight of 448.89 g/mol. Its IUPAC name is (Z)-1-(4-chlorophenyl)-N-[[10-(4-fluorophenyl)-11,12-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]methanimine.
| Compound Name | (Z)-1-(4-chlorophenyl)-N-[[10-(4-fluorophenyl)-11,12-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 41025107 |
| Molecular Formula | C23H18ClFN6O |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | (Z)-1-(4-chlorophenyl)-N-[[10-(4-fluorophenyl)-11,12-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]methanimine |
| SMILES | Cc1c(C)n(-c2ccc(F)cc2)c2ncn3nc(CO/N=C\c4ccc(Cl)cc4)nc3c12 |
| InChI | InChI=1S/C23H18ClFN6O/c1-14-15(2)31(19-9-7-18(25)8-10-19)22-21(14)23-28-20(29-30(23)13-26-22)12-32-27-11-16-3-5-17(24)6-4-16/h3-11,13H,12H2,1-2H3/b27-11- |
| InChIKey | PKHLUYCZHLGVNA-BCHBDCPOSA-N |
| XLogP | 5.03 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|