C27H26N2O8 — CID 41025319
[3-[2-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-2-oxoethyl]-4-methyl-2-oxochromen-7-yl] acetate (PubChem CID 41025319) has the molecular formula C27H26N2O8 and a molecular weight of 506.51 g/mol. Its IUPAC name is [3-[2-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-2-oxoethyl]-4-methyl-2-oxochromen-7-yl] acetate.
| Compound Name | [3-[2-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-2-oxoethyl]-4-methyl-2-oxochromen-7-yl] acetate |
|---|---|
| PubChem CID | 41025319 |
| Molecular Formula | C27H26N2O8 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | [3-[2-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-2-oxoethyl]-4-methyl-2-oxochromen-7-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(C)c(CC(=O)N3CCN(C(=O)[C@@H]4COc5ccccc5O4)CC3)c(=O)oc2c1 |
| InChI | InChI=1S/C27H26N2O8/c1-16-19-8-7-18(35-17(2)30)13-23(19)37-27(33)20(16)14-25(31)28-9-11-29(12-10-28)26(32)24-15-34-21-5-3-4-6-22(21)36-24/h3-8,13,24H,9-12,14-15H2,1-2H3/t24-/m0/s1 |
| InChIKey | CIJKUIGBELVVOD-DEOSSOPVSA-N |
| XLogP | 2.08 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|