C18H17BrClNO3S — CID 41027288
N-[(3-bromophenyl)methyl]-2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 41027288) has the molecular formula C18H17BrClNO3S and a molecular weight of 442.76 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | N-[(3-bromophenyl)methyl]-2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 41027288 |
| Molecular Formula | C18H17BrClNO3S |
| Molecular Weight | 442.76 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(c1ccccc1Cl)N(Cc1cccc(Br)c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H17BrClNO3S/c19-14-5-3-4-13(10-14)11-21(15-8-9-25(23,24)12-15)18(22)16-6-1-2-7-17(16)20/h1-7,10,15H,8-9,11-12H2/t15-/m0/s1 |
| InChIKey | JOXZNDODVOEITG-HNNXBMFYSA-N |
| XLogP | 3.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.76 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |