C19H14FN7O3S — CID 41027732
2-[3-[(2-fluorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]sulfanyl-N-(4-nitrophenyl)acetamide (PubChem CID 41027732) has the molecular formula C19H14FN7O3S and a molecular weight of 439.43 g/mol. Its IUPAC name is 2-[3-[(2-fluorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]sulfanyl-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[3-[(2-fluorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]sulfanyl-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 41027732 |
| Molecular Formula | C19H14FN7O3S |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-[3-[(2-fluorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]sulfanyl-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CSc1ncnc2c1nnn2Cc1ccccc1F)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14FN7O3S/c20-15-4-2-1-3-12(15)9-26-18-17(24-25-26)19(22-11-21-18)31-10-16(28)23-13-5-7-14(8-6-13)27(29)30/h1-8,11H,9-10H2,(H,23,28) |
| InChIKey | MGMWHJLGHRDZLW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|