About 1-methylquinoline-2,4-dione
1-methylquinoline-2,4-dione (PubChem CID 4102778) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-methylquinoline-2,4-dione.
Molecular Properties
| Compound Name | 1-methylquinoline-2,4-dione |
| PubChem CID | 4102778 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 1-methylquinoline-2,4-dione |
| SMILES | CN1C(=O)CC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H9NO2/c1-11-8-5-3-2-4-7(8)9(12)6-10(11)13/h2-5H,6H2,1H3 |
| InChIKey | CLYBXZIOLFPNSX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-methylquinoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylquinoline-2,4-dione?
The IUPAC name of 1-methylquinoline-2,4-dione (CID 4102778) is 1-methylquinoline-2,4-dione.
What is the SMILES notation for 1-methylquinoline-2,4-dione?
The canonical SMILES for 1-methylquinoline-2,4-dione is CN1C(=O)CC(=O)c2ccccc21.
What is the InChIKey of 1-methylquinoline-2,4-dione?
The InChIKey is CLYBXZIOLFPNSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-11-8-5-3-2-4-7(8)9(12)6-10(11)13/h2-5H,6H2,1H3.
What are the key properties of 1-methylquinoline-2,4-dione?
1-methylquinoline-2,4-dione has a molecular weight of 175.19 g/mol, XLogP of 1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylquinoline-2,4-dione is sourced from PubChem (CID 4102778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).