C21H21N3O7 — CID 41028331
N,3-bis(3,4-dimethoxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 41028331) has the molecular formula C21H21N3O7 and a molecular weight of 427.41 g/mol. Its IUPAC name is N,3-bis(3,4-dimethoxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N,3-bis(3,4-dimethoxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 41028331 |
| Molecular Formula | C21H21N3O7 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N,3-bis(3,4-dimethoxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c[nH]c(=O)n(-c3ccc(OC)c(OC)c3)c2=O)cc1OC |
| InChI | InChI=1S/C21H21N3O7/c1-28-15-7-5-12(9-17(15)30-3)23-19(25)14-11-22-21(27)24(20(14)26)13-6-8-16(29-2)18(10-13)31-4/h5-11H,1-4H3,(H,22,27)(H,23,25) |
| InChIKey | MBPDCABQDNWHCW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |