C27H24N2O6 — CID 41036404
N-[4-[(2S)-2-(2,4-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 41036404) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is N-[4-[(2S)-2-(2,4-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(2S)-2-(2,4-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 41036404 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-[4-[(2S)-2-(2,4-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | COc1ccc([C@H]2C(=C(O)c3ccccc3)C(=O)C(=O)N2c2ccc(NC(C)=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H24N2O6/c1-16(30)28-18-9-11-19(12-10-18)29-24(21-14-13-20(34-2)15-22(21)35-3)23(26(32)27(29)33)25(31)17-7-5-4-6-8-17/h4-15,24,31H,1-3H3,(H,28,30)/t24-/m0/s1 |
| InChIKey | RJLRAVGFLZZCMV-DEOSSOPVSA-N |
| XLogP | 4.29 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|