C13H14N4O3 — CID 4103758
N-benzyl-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide (PubChem CID 4103758) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-benzyl-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide.
| Compound Name | N-benzyl-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide |
|---|---|
| PubChem CID | 4103758 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-benzyl-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide |
| SMILES | O=C(CCc1n[nH]c(=O)[nH]c1=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H14N4O3/c18-11(14-8-9-4-2-1-3-5-9)7-6-10-12(19)15-13(20)17-16-10/h1-5H,6-8H2,(H,14,18)(H2,15,17,19,20) |
| InChIKey | QTDYQUHOUIDAQM-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |