C22H23ClFNO5 — CID 41039133
[(2R)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 3-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate (PubChem CID 41039133) has the molecular formula C22H23ClFNO5 and a molecular weight of 435.88 g/mol. Its IUPAC name is [(2R)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 3-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate.
| Compound Name | [(2R)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 3-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
|---|---|
| PubChem CID | 41039133 |
| Molecular Formula | C22H23ClFNO5 |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [(2R)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 3-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
| SMILES | O=C(CCN1C(=O)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O)O[C@H](CCCl)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23ClFNO5/c23-9-7-16(20(27)12-3-5-15(24)6-4-12)30-17(26)8-10-25-21(28)18-13-1-2-14(11-13)19(18)22(25)29/h3-6,13-14,16,18-19H,1-2,7-11H2/t13-,14+,16-,18+,19+/m1/s1 |
| InChIKey | WNUICOLQRVMPRT-KZYWPTACSA-N |
| XLogP | 2.97 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|