C20H18F3N3O4S2 — CID 41039419
3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41039419) has the molecular formula C20H18F3N3O4S2 and a molecular weight of 485.51 g/mol. Its IUPAC name is 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41039419 |
| Molecular Formula | C20H18F3N3O4S2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cccc(C(=O)Nc3nc4c(F)c(F)c(F)cc4s3)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C20H18F3N3O4S2/c1-10-8-26(9-11(2)30-10)32(28,29)13-5-3-4-12(6-13)19(27)25-20-24-18-15(31-20)7-14(21)16(22)17(18)23/h3-7,10-11H,8-9H2,1-2H3,(H,24,25,27)/t10-,11-/m1/s1 |
| InChIKey | JFDXJGHPZLYRDG-GHMZBOCLSA-N |
| XLogP | 3.76 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|