C20H20ClF3N2O4 — CID 4103972
ethyl 2-(3-chloro-2-methylanilino)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]propanoate (PubChem CID 4103972) has the molecular formula C20H20ClF3N2O4 and a molecular weight of 444.84 g/mol. Its IUPAC name is ethyl 2-(3-chloro-2-methylanilino)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]propanoate.
| Compound Name | ethyl 2-(3-chloro-2-methylanilino)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 4103972 |
| Molecular Formula | C20H20ClF3N2O4 |
| Molecular Weight | 444.84 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | ethyl 2-(3-chloro-2-methylanilino)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1ccc(OC)cc1)(Nc1cccc(Cl)c1C)C(F)(F)F |
| InChI | InChI=1S/C20H20ClF3N2O4/c1-4-30-18(28)19(20(22,23)24,25-16-7-5-6-15(21)12(16)2)26-17(27)13-8-10-14(29-3)11-9-13/h5-11,25H,4H2,1-3H3,(H,26,27) |
| InChIKey | BPFRKNSPNSFWHY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|