C27H21Cl2NO4 — CID 41040268
(5S)-1-benzyl-5-(3,4-dichlorophenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione (PubChem CID 41040268) has the molecular formula C27H21Cl2NO4 and a molecular weight of 494.37 g/mol. Its IUPAC name is (5S)-1-benzyl-5-(3,4-dichlorophenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (5S)-1-benzyl-5-(3,4-dichlorophenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41040268 |
| Molecular Formula | C27H21Cl2NO4 |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | (5S)-1-benzyl-5-(3,4-dichlorophenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
| SMILES | C[C@H]1Cc2cc(C(O)=C3C(=O)C(=O)N(Cc4ccccc4)[C@H]3c3ccc(Cl)c(Cl)c3)ccc2O1 |
| InChI | InChI=1S/C27H21Cl2NO4/c1-15-11-19-12-18(8-10-22(19)34-15)25(31)23-24(17-7-9-20(28)21(29)13-17)30(27(33)26(23)32)14-16-5-3-2-4-6-16/h2-10,12-13,15,24,31H,11,14H2,1H3/t15-,24-/m0/s1 |
| InChIKey | UEIAWULNEOUWDL-OWJWWREXSA-N |
| XLogP | 5.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|