C14H8O6-2 — CID 4104299
2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate (PubChem CID 4104299) has the molecular formula C14H8O6-2 and a molecular weight of 272.21 g/mol. Its IUPAC name is 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate.
| Compound Name | 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate |
|---|---|
| PubChem CID | 4104299 |
| Molecular Formula | C14H8O6-2 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate |
| SMILES | Cc1oc2cc3c(C(=O)[O-])c(C)oc3cc2c1C(=O)[O-] |
| InChI | InChI=1S/C14H10O6/c1-5-11(13(15)16)7-3-10-8(4-9(7)19-5)12(14(17)18)6(2)20-10/h3-4H,1-2H3,(H,15,16)(H,17,18)/p-2 |
| InChIKey | CJDTVCZYNIQORD-UHFFFAOYSA-L |
| XLogP | 0.52 |
| TPSA | 106.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |