C22H39N3 — CID 4104336
5,5-dimethyl-3-piperidin-1-yl-N-(2,2,6,6-tetramethylpiperidin-4-yl)cyclohex-2-en-1-imine (PubChem CID 4104336) has the molecular formula C22H39N3 and a molecular weight of 345.58 g/mol. Its IUPAC name is 5,5-dimethyl-3-piperidin-1-yl-N-(2,2,6,6-tetramethylpiperidin-4-yl)cyclohex-2-en-1-imine.
| Compound Name | 5,5-dimethyl-3-piperidin-1-yl-N-(2,2,6,6-tetramethylpiperidin-4-yl)cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 4104336 |
| Molecular Formula | C22H39N3 |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 345.31 |
| IUPAC Name | 5,5-dimethyl-3-piperidin-1-yl-N-(2,2,6,6-tetramethylpiperidin-4-yl)cyclohex-2-en-1-imine |
| SMILES | CC1(C)CC(N2CCCCC2)=C/C(=N\C2CC(C)(C)NC(C)(C)C2)C1 |
| InChI | InChI=1S/C22H39N3/c1-20(2)13-17(12-19(16-20)25-10-8-7-9-11-25)23-18-14-21(3,4)24-22(5,6)15-18/h12,18,24H,7-11,13-16H2,1-6H3/b23-17+ |
| InChIKey | KZKALSHLGZXGHK-HAVVHWLPSA-N |
| XLogP | 4.93 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|