C14H16N4O4S — CID 4104774
N-(2,4-dimethylphenyl)-5-hydrazinyl-2-nitrobenzenesulfonamide (PubChem CID 4104774) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-5-hydrazinyl-2-nitrobenzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-5-hydrazinyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4104774 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-(2,4-dimethylphenyl)-5-hydrazinyl-2-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(NN)ccc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C14H16N4O4S/c1-9-3-5-12(10(2)7-9)17-23(21,22)14-8-11(16-15)4-6-13(14)18(19)20/h3-8,16-17H,15H2,1-2H3 |
| InChIKey | GXYBKVOQJLYEOE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|