C19H17NO5 — CID 41048388
methyl 3-[[(3R)-3-methyl-1-oxo-4H-isochromene-3-carbonyl]amino]benzoate (PubChem CID 41048388) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is methyl 3-[[(3R)-3-methyl-1-oxo-4H-isochromene-3-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[(3R)-3-methyl-1-oxo-4H-isochromene-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 41048388 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | methyl 3-[[(3R)-3-methyl-1-oxo-4H-isochromene-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)[C@@]2(C)Cc3ccccc3C(=O)O2)c1 |
| InChI | InChI=1S/C19H17NO5/c1-19(11-13-6-3-4-9-15(13)17(22)25-19)18(23)20-14-8-5-7-12(10-14)16(21)24-2/h3-10H,11H2,1-2H3,(H,20,23)/t19-/m1/s1 |
| InChIKey | IWFCCOCXXJRWOA-LJQANCHMSA-N |
| XLogP | 2.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |