About 1,3-dimethylbenzene-5-ide;iodozinc(1+)
1,3-dimethylbenzene-5-ide;iodozinc(1+) (PubChem CID 4104848) has the molecular formula C8H9IZn
and a molecular weight of 297.45 g/mol. Its IUPAC name is 1,3-dimethylbenzene-5-ide;iodozinc(1+).
Molecular Properties
| Compound Name | 1,3-dimethylbenzene-5-ide;iodozinc(1+) |
| PubChem CID | 4104848 |
| Molecular Formula | C8H9IZn |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 295.90 |
| IUPAC Name | 1,3-dimethylbenzene-5-ide;iodozinc(1+) |
| SMILES | Cc1c[c-]cc(C)c1.[Zn+]I |
| InChI | InChI=1S/C8H9.HI.Zn/c1-7-4-3-5-8(2)6-7;;/h4-6H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | BSYFSJQVIZBAMI-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylbenzene-5-ide;iodozinc(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylbenzene-5-ide;iodozinc(1+)?
The IUPAC name of 1,3-dimethylbenzene-5-ide;iodozinc(1+) (CID 4104848) is 1,3-dimethylbenzene-5-ide;iodozinc(1+).
What is the SMILES notation for 1,3-dimethylbenzene-5-ide;iodozinc(1+)?
The canonical SMILES for 1,3-dimethylbenzene-5-ide;iodozinc(1+) is Cc1c[c-]cc(C)c1.[Zn+]I.
What is the InChIKey of 1,3-dimethylbenzene-5-ide;iodozinc(1+)?
The InChIKey is BSYFSJQVIZBAMI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9.HI.Zn/c1-7-4-3-5-8(2)6-7;;/h4-6H,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of 1,3-dimethylbenzene-5-ide;iodozinc(1+)?
1,3-dimethylbenzene-5-ide;iodozinc(1+) has a molecular weight of 297.45 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylbenzene-5-ide;iodozinc(1+) is sourced from PubChem (CID 4104848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).