C42H34N4+2 — CID 4104906
2-[4-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-ium-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium (PubChem CID 4104906) has the molecular formula C42H34N4+2 and a molecular weight of 594.76 g/mol. Its IUPAC name is 2-[4-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-ium-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium.
| Compound Name | 2-[4-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-ium-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium |
|---|---|
| PubChem CID | 4104906 |
| Molecular Formula | C42H34N4+2 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 2-[4-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-ium-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium |
| SMILES | C1=CC(=[N+]2N=C(c3ccccc3)CC2c2ccccc2)C=CC1=C1C=CC(=[N+]2N=C(c3ccccc3)CC2c2ccccc2)C=C1 |
| InChI | InChI=1S/C42H34N4/c1-5-13-33(14-6-1)39-29-41(35-17-9-3-10-18-35)45(43-39)37-25-21-31(22-26-37)32-23-27-38(28-24-32)46-42(36-19-11-4-12-20-36)30-40(44-46)34-15-7-2-8-16-34/h1-28,41-42H,29-30H2/q+2 |
| InChIKey | AUUCPGGJHZQIPI-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 30.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|