C23H31N3O3S2 — CID 41057933
(3R,9bS)-N-[(2S)-1-(cyclopentylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 41057933) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is (3R,9bS)-N-[(2S)-1-(cyclopentylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | (3R,9bS)-N-[(2S)-1-(cyclopentylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 41057933 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (3R,9bS)-N-[(2S)-1-(cyclopentylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | CSCC[C@H](NC(=O)[C@H]1N2C(=O)c3ccccc3[C@@H]2SC1(C)C)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C23H31N3O3S2/c1-23(2)18(26-21(29)15-10-6-7-11-16(15)22(26)31-23)20(28)25-17(12-13-30-3)19(27)24-14-8-4-5-9-14/h6-7,10-11,14,17-18,22H,4-5,8-9,12-13H2,1-3H3,(H,24,27)(H,25,28)/t17-,18+,22-/m0/s1 |
| InChIKey | CFPMLKNOQUURBW-SVMVAKDDSA-N |
| XLogP | 3.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |