C20H26N2O6S2 — CID 41063995
5-[[(3aR,6aS)-3-(3-butoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid (PubChem CID 41063995) has the molecular formula C20H26N2O6S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 5-[[(3aR,6aS)-3-(3-butoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[(3aR,6aS)-3-(3-butoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 41063995 |
| Molecular Formula | C20H26N2O6S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 5-[[(3aR,6aS)-3-(3-butoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid |
| SMILES | CCCCOc1cccc(N2/C(=N/C(=O)CCCC(=O)O)S[C@@H]3CS(=O)(=O)C[C@H]32)c1 |
| InChI | InChI=1S/C20H26N2O6S2/c1-2-3-10-28-15-7-4-6-14(11-15)22-16-12-30(26,27)13-17(16)29-20(22)21-18(23)8-5-9-19(24)25/h4,6-7,11,16-17H,2-3,5,8-10,12-13H2,1H3,(H,24,25)/b21-20-/t16-,17-/m1/s1 |
| InChIKey | FHSNKMUGSSOLDD-XDLCVMBESA-N |
| XLogP | 2.72 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|