C20H23N3O — CID 4106595
3-methyl-N-[2-(1-propan-2-ylbenzimidazol-2-yl)ethyl]benzamide (PubChem CID 4106595) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-methyl-N-[2-(1-propan-2-ylbenzimidazol-2-yl)ethyl]benzamide.
| Compound Name | 3-methyl-N-[2-(1-propan-2-ylbenzimidazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 4106595 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 3-methyl-N-[2-(1-propan-2-ylbenzimidazol-2-yl)ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCCc2nc3ccccc3n2C(C)C)c1 |
| InChI | InChI=1S/C20H23N3O/c1-14(2)23-18-10-5-4-9-17(18)22-19(23)11-12-21-20(24)16-8-6-7-15(3)13-16/h4-10,13-14H,11-12H2,1-3H3,(H,21,24) |
| InChIKey | PDGVILJVFPQKCB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |